C11H17BrN2 — CID 167637244
4-(5-bromo-2-pyridinyl)-N,N-dimethylbutan-1-amine (PubChem CID 167637244) has the molecular formula C11H17BrN2 and a molecular weight of 257.18 g/mol. Its IUPAC name is 4-(5-bromo-2-pyridinyl)-N,N-dimethylbutan-1-amine.
| Compound Name | 4-(5-bromo-2-pyridinyl)-N,N-dimethylbutan-1-amine |
|---|---|
| PubChem CID | 167637244 |
| Molecular Formula | C11H17BrN2 |
| Molecular Weight | 257.18 g/mol |
| Exact Mass | 256.06 |
| IUPAC Name | 4-(5-bromo-2-pyridinyl)-N,N-dimethylbutan-1-amine |
| SMILES | CN(C)CCCCc1ccc(Br)cn1 |
| InChI | InChI=1S/C11H17BrN2/c1-14(2)8-4-3-5-11-7-6-10(12)9-13-11/h6-7,9H,3-5,8H2,1-2H3 |
| InChIKey | HPHSEHXQXPLDJJ-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.18 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|