C8H12BrN3 — CID 105487467
2-(5-bromopyrimidin-2-yl)-N,N-dimethylethanamine (PubChem CID 105487467) has the molecular formula C8H12BrN3 and a molecular weight of 230.11 g/mol. Its IUPAC name is 2-(5-bromopyrimidin-2-yl)-N,N-dimethylethanamine.
| Compound Name | 2-(5-bromopyrimidin-2-yl)-N,N-dimethylethanamine |
|---|---|
| PubChem CID | 105487467 |
| Molecular Formula | C8H12BrN3 |
| Molecular Weight | 230.11 g/mol |
| Exact Mass | 229.02 |
| IUPAC Name | 2-(5-bromopyrimidin-2-yl)-N,N-dimethylethanamine |
| SMILES | CN(C)CCc1ncc(Br)cn1 |
| InChI | InChI=1S/C8H12BrN3/c1-12(2)4-3-8-10-5-7(9)6-11-8/h5-6H,3-4H2,1-2H3 |
| InChIKey | RUYOJYDOFXDCPI-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 29.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.11 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |