C9H14ClN3 — CID 115347152
2-[5-(chloromethyl)pyrimidin-2-yl]-N,N-dimethylethanamine (PubChem CID 115347152) has the molecular formula C9H14ClN3 and a molecular weight of 199.69 g/mol. Its IUPAC name is 2-[5-(chloromethyl)pyrimidin-2-yl]-N,N-dimethylethanamine.
| Compound Name | 2-[5-(chloromethyl)pyrimidin-2-yl]-N,N-dimethylethanamine |
|---|---|
| PubChem CID | 115347152 |
| Molecular Formula | C9H14ClN3 |
| Molecular Weight | 199.69 g/mol |
| Exact Mass | 199.09 |
| IUPAC Name | 2-[5-(chloromethyl)pyrimidin-2-yl]-N,N-dimethylethanamine |
| SMILES | CN(C)CCc1ncc(CCl)cn1 |
| InChI | InChI=1S/C9H14ClN3/c1-13(2)4-3-9-11-6-8(5-10)7-12-9/h6-7H,3-5H2,1-2H3 |
| InChIKey | KGSJCWBWFFHULC-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 29.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.69 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|