C9H18ClF2NO2 — CID 107487831
N-(2-chloroethyl)-2,2-difluoro-N-[2-(2-methoxyethoxy)ethyl]ethanamine (PubChem CID 107487831) has the molecular formula C9H18ClF2NO2 and a molecular weight of 245.70 g/mol. Its IUPAC name is N-(2-chloroethyl)-2,2-difluoro-N-[2-(2-methoxyethoxy)ethyl]ethanamine.
| Compound Name | N-(2-chloroethyl)-2,2-difluoro-N-[2-(2-methoxyethoxy)ethyl]ethanamine |
|---|---|
| PubChem CID | 107487831 |
| Molecular Formula | C9H18ClF2NO2 |
| Molecular Weight | 245.70 g/mol |
| Exact Mass | 245.10 |
| IUPAC Name | N-(2-chloroethyl)-2,2-difluoro-N-[2-(2-methoxyethoxy)ethyl]ethanamine |
| SMILES | COCCOCCN(CCCl)CC(F)F |
| InChI | InChI=1S/C9H18ClF2NO2/c1-14-6-7-15-5-4-13(3-2-10)8-9(11)12/h9H,2-8H2,1H3 |
| InChIKey | XEWYKXAPLRVRKJ-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.70 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|