C8H17F2NO2S — CID 107494993
2-[2,2-difluoroethyl-[2-(2-sulfanylethoxy)ethyl]amino]ethanol (PubChem CID 107494993) has the molecular formula C8H17F2NO2S and a molecular weight of 229.29 g/mol. Its IUPAC name is 2-[2,2-difluoroethyl-[2-(2-sulfanylethoxy)ethyl]amino]ethanol.
| Compound Name | 2-[2,2-difluoroethyl-[2-(2-sulfanylethoxy)ethyl]amino]ethanol |
|---|---|
| PubChem CID | 107494993 |
| Molecular Formula | C8H17F2NO2S |
| Molecular Weight | 229.29 g/mol |
| Exact Mass | 229.09 |
| IUPAC Name | 2-[2,2-difluoroethyl-[2-(2-sulfanylethoxy)ethyl]amino]ethanol |
| SMILES | OCCN(CCOCCS)CC(F)F |
| InChI | InChI=1S/C8H17F2NO2S/c9-8(10)7-11(1-3-12)2-4-13-5-6-14/h8,12,14H,1-7H2 |
| InChIKey | CLWSTUXSIQMTLK-UHFFFAOYSA-N |
| XLogP | 0.49 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.29 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|