C13H19F2N3O3 — CID 107493128
4-[2-[2,2-difluoroethyl(2-hydroxyethyl)amino]ethoxy]benzohydrazide (PubChem CID 107493128) has the molecular formula C13H19F2N3O3 and a molecular weight of 303.31 g/mol. Its IUPAC name is 4-[2-[2,2-difluoroethyl(2-hydroxyethyl)amino]ethoxy]benzohydrazide.
| Compound Name | 4-[2-[2,2-difluoroethyl(2-hydroxyethyl)amino]ethoxy]benzohydrazide |
|---|---|
| PubChem CID | 107493128 |
| Molecular Formula | C13H19F2N3O3 |
| Molecular Weight | 303.31 g/mol |
| Exact Mass | 303.14 |
| IUPAC Name | 4-[2-[2,2-difluoroethyl(2-hydroxyethyl)amino]ethoxy]benzohydrazide |
| SMILES | NNC(=O)c1ccc(OCCN(CCO)CC(F)F)cc1 |
| InChI | InChI=1S/C13H19F2N3O3/c14-12(15)9-18(5-7-19)6-8-21-11-3-1-10(2-4-11)13(20)17-16/h1-4,12,19H,5-9,16H2,(H,17,20) |
| InChIKey | IOHUMULPJXJEFA-UHFFFAOYSA-N |
| XLogP | 0.23 |
| TPSA | 87.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.31 |
| LogP ≤ 5 | 0.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|