C14H23N3O3 — CID 63583247
3-[2-[2-hydroxyethyl(propyl)amino]ethoxy]benzohydrazide (PubChem CID 63583247) has the molecular formula C14H23N3O3 and a molecular weight of 281.36 g/mol. Its IUPAC name is 3-[2-[2-hydroxyethyl(propyl)amino]ethoxy]benzohydrazide.
| Compound Name | 3-[2-[2-hydroxyethyl(propyl)amino]ethoxy]benzohydrazide |
|---|---|
| PubChem CID | 63583247 |
| Molecular Formula | C14H23N3O3 |
| Molecular Weight | 281.36 g/mol |
| Exact Mass | 281.17 |
| IUPAC Name | 3-[2-[2-hydroxyethyl(propyl)amino]ethoxy]benzohydrazide |
| SMILES | CCCN(CCO)CCOc1cccc(C(=O)NN)c1 |
| InChI | InChI=1S/C14H23N3O3/c1-2-6-17(7-9-18)8-10-20-13-5-3-4-12(11-13)14(19)16-15/h3-5,11,18H,2,6-10,15H2,1H3,(H,16,19) |
| InChIKey | ZJSAZILXNSLHAC-UHFFFAOYSA-N |
| XLogP | 0.37 |
| TPSA | 87.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.36 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|