C8H17F2NOS — CID 107494982
2-[2,2-difluoroethyl-(2-methyl-3-sulfanylpropyl)amino]ethanol (PubChem CID 107494982) has the molecular formula C8H17F2NOS and a molecular weight of 213.29 g/mol. Its IUPAC name is 2-[2,2-difluoroethyl-(2-methyl-3-sulfanylpropyl)amino]ethanol.
| Compound Name | 2-[2,2-difluoroethyl-(2-methyl-3-sulfanylpropyl)amino]ethanol |
|---|---|
| PubChem CID | 107494982 |
| Molecular Formula | C8H17F2NOS |
| Molecular Weight | 213.29 g/mol |
| Exact Mass | 213.10 |
| IUPAC Name | 2-[2,2-difluoroethyl-(2-methyl-3-sulfanylpropyl)amino]ethanol |
| SMILES | CC(CS)CN(CCO)CC(F)F |
| InChI | InChI=1S/C8H17F2NOS/c1-7(6-13)4-11(2-3-12)5-8(9)10/h7-8,12-13H,2-6H2,1H3 |
| InChIKey | UGHIKACJEVTVFS-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.29 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|