C11H23F2NO2 — CID 107484971
2-[2,2-difluoroethyl-[2-(3-methylbutoxy)ethyl]amino]ethanol (PubChem CID 107484971) has the molecular formula C11H23F2NO2 and a molecular weight of 239.31 g/mol. Its IUPAC name is 2-[2,2-difluoroethyl-[2-(3-methylbutoxy)ethyl]amino]ethanol.
| Compound Name | 2-[2,2-difluoroethyl-[2-(3-methylbutoxy)ethyl]amino]ethanol |
|---|---|
| PubChem CID | 107484971 |
| Molecular Formula | C11H23F2NO2 |
| Molecular Weight | 239.31 g/mol |
| Exact Mass | 239.17 |
| IUPAC Name | 2-[2,2-difluoroethyl-[2-(3-methylbutoxy)ethyl]amino]ethanol |
| SMILES | CC(C)CCOCCN(CCO)CC(F)F |
| InChI | InChI=1S/C11H23F2NO2/c1-10(2)3-7-16-8-5-14(4-6-15)9-11(12)13/h10-11,15H,3-9H2,1-2H3 |
| InChIKey | OCLXMWBAOIARSG-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.31 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|