C17H37NO4 — CID 167143276
5-methoxy-N-[2-(2-methoxyethoxy)ethyl]-N-(5-methoxypentyl)pentan-1-amine (PubChem CID 167143276) has the molecular formula C17H37NO4 and a molecular weight of 319.49 g/mol. Its IUPAC name is 5-methoxy-N-[2-(2-methoxyethoxy)ethyl]-N-(5-methoxypentyl)pentan-1-amine.
| Compound Name | 5-methoxy-N-[2-(2-methoxyethoxy)ethyl]-N-(5-methoxypentyl)pentan-1-amine |
|---|---|
| PubChem CID | 167143276 |
| Molecular Formula | C17H37NO4 |
| Molecular Weight | 319.49 g/mol |
| Exact Mass | 319.27 |
| IUPAC Name | 5-methoxy-N-[2-(2-methoxyethoxy)ethyl]-N-(5-methoxypentyl)pentan-1-amine |
| SMILES | COCCCCCN(CCCCCOC)CCOCCOC |
| InChI | InChI=1S/C17H37NO4/c1-19-13-8-4-6-10-18(11-7-5-9-14-20-2)12-15-22-17-16-21-3/h4-17H2,1-3H3 |
| InChIKey | CWRBHLOJQBNTKR-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 40.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.49 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|