C11H24ClNO2 — CID 61418354
5-chloro-N,N-bis(2-methoxyethyl)pentan-1-amine (PubChem CID 61418354) has the molecular formula C11H24ClNO2 and a molecular weight of 237.77 g/mol. Its IUPAC name is 5-chloro-N,N-bis(2-methoxyethyl)pentan-1-amine.
| Compound Name | 5-chloro-N,N-bis(2-methoxyethyl)pentan-1-amine |
|---|---|
| PubChem CID | 61418354 |
| Molecular Formula | C11H24ClNO2 |
| Molecular Weight | 237.77 g/mol |
| Exact Mass | 237.15 |
| IUPAC Name | 5-chloro-N,N-bis(2-methoxyethyl)pentan-1-amine |
| SMILES | COCCN(CCCCCCl)CCOC |
| InChI | InChI=1S/C11H24ClNO2/c1-14-10-8-13(9-11-15-2)7-5-3-4-6-12/h3-11H2,1-2H3 |
| InChIKey | YPAYXDRYCYHZOE-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.77 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|