C28H33O6P — CID 155575547
[benzyl-[3-hydroxy-2-(3-methylphenyl)-5-pentylphenoxy]phosphoryl]oxymethyl acetate (PubChem CID 155575547) has the molecular formula C28H33O6P and a molecular weight of 496.54 g/mol. Its IUPAC name is [benzyl-[3-hydroxy-2-(3-methylphenyl)-5-pentylphenoxy]phosphoryl]oxymethyl acetate.
| Compound Name | [benzyl-[3-hydroxy-2-(3-methylphenyl)-5-pentylphenoxy]phosphoryl]oxymethyl acetate |
|---|---|
| PubChem CID | 155575547 |
| Molecular Formula | C28H33O6P |
| Molecular Weight | 496.54 g/mol |
| Exact Mass | 496.20 |
| IUPAC Name | [benzyl-[3-hydroxy-2-(3-methylphenyl)-5-pentylphenoxy]phosphoryl]oxymethyl acetate |
| SMILES | CCCCCc1cc(O)c(-c2cccc(C)c2)c(OP(=O)(Cc2ccccc2)OCOC(C)=O)c1 |
| InChI | InChI=1S/C28H33O6P/c1-4-5-7-14-24-17-26(30)28(25-15-10-11-21(2)16-25)27(18-24)34-35(31,33-20-32-22(3)29)19-23-12-8-6-9-13-23/h6,8-13,15-18,30H,4-5,7,14,19-20H2,1-3H3 |
| InChIKey | OAMXOGNXEVQFBK-UHFFFAOYSA-N |
| XLogP | 7.41 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.54 |
| LogP ≤ 5 | 7.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|