C26H33O6P — CID 155575600
3-[methoxy-(9-methyl-6-methylidene-3-pentylbenzo[c]chromen-1-yl)oxyphosphoryl]propyl acetate (PubChem CID 155575600) has the molecular formula C26H33O6P and a molecular weight of 472.52 g/mol. Its IUPAC name is 3-[methoxy-(9-methyl-6-methylidene-3-pentylbenzo[c]chromen-1-yl)oxyphosphoryl]propyl acetate.
| Compound Name | 3-[methoxy-(9-methyl-6-methylidene-3-pentylbenzo[c]chromen-1-yl)oxyphosphoryl]propyl acetate |
|---|---|
| PubChem CID | 155575600 |
| Molecular Formula | C26H33O6P |
| Molecular Weight | 472.52 g/mol |
| Exact Mass | 472.20 |
| IUPAC Name | 3-[methoxy-(9-methyl-6-methylidene-3-pentylbenzo[c]chromen-1-yl)oxyphosphoryl]propyl acetate |
| SMILES | C=C1Oc2cc(CCCCC)cc(OP(=O)(CCCOC(C)=O)OC)c2-c2cc(C)ccc21 |
| InChI | InChI=1S/C26H33O6P/c1-6-7-8-10-21-16-24-26(23-15-18(2)11-12-22(23)19(3)31-24)25(17-21)32-33(28,29-5)14-9-13-30-20(4)27/h11-12,15-17H,3,6-10,13-14H2,1-2,4-5H3 |
| InChIKey | MYMXKAJSPFRCCU-UHFFFAOYSA-N |
| XLogP | 6.93 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.52 |
| LogP ≤ 5 | 6.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|