C28H31O3P — CID 155575479
benzyl-methoxy-(9-methyl-6-methylidene-3-pentylbenzo[c]chromen-1-yl)oxyphosphane (PubChem CID 155575479) has the molecular formula C28H31O3P and a molecular weight of 446.53 g/mol. Its IUPAC name is benzyl-methoxy-(9-methyl-6-methylidene-3-pentylbenzo[c]chromen-1-yl)oxyphosphane.
| Compound Name | benzyl-methoxy-(9-methyl-6-methylidene-3-pentylbenzo[c]chromen-1-yl)oxyphosphane |
|---|---|
| PubChem CID | 155575479 |
| Molecular Formula | C28H31O3P |
| Molecular Weight | 446.53 g/mol |
| Exact Mass | 446.20 |
| IUPAC Name | benzyl-methoxy-(9-methyl-6-methylidene-3-pentylbenzo[c]chromen-1-yl)oxyphosphane |
| SMILES | C=C1Oc2cc(CCCCC)cc(OP(Cc3ccccc3)OC)c2-c2cc(C)ccc21 |
| InChI | InChI=1S/C28H31O3P/c1-5-6-8-13-23-17-26-28(25-16-20(2)14-15-24(25)21(3)30-26)27(18-23)31-32(29-4)19-22-11-9-7-10-12-22/h7,9-12,14-18H,3,5-6,8,13,19H2,1-2,4H3 |
| InChIKey | YODCXFGZSXIBGU-UHFFFAOYSA-N |
| XLogP | 8.30 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.53 |
| LogP ≤ 5 | 8.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|