C26H34O3 — CID 118642883
(6,6,9-trimethyl-3-pentylbenzo[c]chromen-1-yl) pentanoate (PubChem CID 118642883) has the molecular formula C26H34O3 and a molecular weight of 394.56 g/mol. Its IUPAC name is (6,6,9-trimethyl-3-pentylbenzo[c]chromen-1-yl) pentanoate.
| Compound Name | (6,6,9-trimethyl-3-pentylbenzo[c]chromen-1-yl) pentanoate |
|---|---|
| PubChem CID | 118642883 |
| Molecular Formula | C26H34O3 |
| Molecular Weight | 394.56 g/mol |
| Exact Mass | 394.25 |
| IUPAC Name | (6,6,9-trimethyl-3-pentylbenzo[c]chromen-1-yl) pentanoate |
| SMILES | CCCCCc1cc(OC(=O)CCCC)c2c(c1)OC(C)(C)c1ccc(C)cc1-2 |
| InChI | InChI=1S/C26H34O3/c1-6-8-10-11-19-16-22(28-24(27)12-9-7-2)25-20-15-18(3)13-14-21(20)26(4,5)29-23(25)17-19/h13-17H,6-12H2,1-5H3 |
| InChIKey | HXHOZMDREQXXCS-UHFFFAOYSA-N |
| XLogP | 7.12 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.56 |
| LogP ≤ 5 | 7.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|