C23H26O5 — CID 155242166
1-formyloxy-6,6,9-trimethyl-3-pentylbenzo[c]chromene-2-carboxylic acid (PubChem CID 155242166) has the molecular formula C23H26O5 and a molecular weight of 382.46 g/mol. Its IUPAC name is 1-formyloxy-6,6,9-trimethyl-3-pentylbenzo[c]chromene-2-carboxylic acid.
| Compound Name | 1-formyloxy-6,6,9-trimethyl-3-pentylbenzo[c]chromene-2-carboxylic acid |
|---|---|
| PubChem CID | 155242166 |
| Molecular Formula | C23H26O5 |
| Molecular Weight | 382.46 g/mol |
| Exact Mass | 382.18 |
| IUPAC Name | 1-formyloxy-6,6,9-trimethyl-3-pentylbenzo[c]chromene-2-carboxylic acid |
| SMILES | CCCCCc1cc2c(c(OC=O)c1C(=O)O)-c1cc(C)ccc1C(C)(C)O2 |
| InChI | InChI=1S/C23H26O5/c1-5-6-7-8-15-12-18-20(21(27-13-24)19(15)22(25)26)16-11-14(2)9-10-17(16)23(3,4)28-18/h9-13H,5-8H2,1-4H3,(H,25,26) |
| InChIKey | MGDOZWFOWHAANC-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.46 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|