C24H27NO2S — CID 155575201
6,6,9-trimethyl-3-pentyl-2-(1,3-thiazol-5-yl)benzo[c]chromen-1-ol (PubChem CID 155575201) has the molecular formula C24H27NO2S and a molecular weight of 393.55 g/mol. Its IUPAC name is 6,6,9-trimethyl-3-pentyl-2-(1,3-thiazol-5-yl)benzo[c]chromen-1-ol.
| Compound Name | 6,6,9-trimethyl-3-pentyl-2-(1,3-thiazol-5-yl)benzo[c]chromen-1-ol |
|---|---|
| PubChem CID | 155575201 |
| Molecular Formula | C24H27NO2S |
| Molecular Weight | 393.55 g/mol |
| Exact Mass | 393.18 |
| IUPAC Name | 6,6,9-trimethyl-3-pentyl-2-(1,3-thiazol-5-yl)benzo[c]chromen-1-ol |
| SMILES | CCCCCc1cc2c(c(O)c1-c1cncs1)-c1cc(C)ccc1C(C)(C)O2 |
| InChI | InChI=1S/C24H27NO2S/c1-5-6-7-8-16-12-19-22(23(26)21(16)20-13-25-14-28-20)17-11-15(2)9-10-18(17)24(3,4)27-19/h9-14,26H,5-8H2,1-4H3 |
| InChIKey | SNNOURWKNHWVMQ-UHFFFAOYSA-N |
| XLogP | 6.85 |
| TPSA | 42.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.55 |
| LogP ≤ 5 | 6.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|