C24H29BO4 — CID 91750650
2-butyl-8,8,11-trimethyl-5-propylisochromeno[3,4-h][1,3,2]benzodioxaborinin-4-one (PubChem CID 91750650) has the molecular formula C24H29BO4 and a molecular weight of 392.30 g/mol. Its IUPAC name is 2-butyl-8,8,11-trimethyl-5-propylisochromeno[3,4-h][1,3,2]benzodioxaborinin-4-one.
| Compound Name | 2-butyl-8,8,11-trimethyl-5-propylisochromeno[3,4-h][1,3,2]benzodioxaborinin-4-one |
|---|---|
| PubChem CID | 91750650 |
| Molecular Formula | C24H29BO4 |
| Molecular Weight | 392.30 g/mol |
| Exact Mass | 392.22 |
| IUPAC Name | 2-butyl-8,8,11-trimethyl-5-propylisochromeno[3,4-h][1,3,2]benzodioxaborinin-4-one |
| SMILES | CCCCB1OC(=O)c2c(CCC)cc3c(c2O1)-c1cc(C)ccc1C(C)(C)O3 |
| InChI | InChI=1S/C24H29BO4/c1-6-8-12-25-28-22-20(23(26)29-25)16(9-7-2)14-19-21(22)17-13-15(3)10-11-18(17)24(4,5)27-19/h10-11,13-14H,6-9,12H2,1-5H3 |
| InChIKey | HMMDBYNJFYKYMO-UHFFFAOYSA-N |
| XLogP | 6.08 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.30 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|