C20H24O4 — CID 162680211
(1-hydroxy-6,6,9-trimethyl-3-propylbenzo[c]chromen-2-yl)methanediol (PubChem CID 162680211) has the molecular formula C20H24O4 and a molecular weight of 328.41 g/mol. Its IUPAC name is (1-hydroxy-6,6,9-trimethyl-3-propylbenzo[c]chromen-2-yl)methanediol.
| Compound Name | (1-hydroxy-6,6,9-trimethyl-3-propylbenzo[c]chromen-2-yl)methanediol |
|---|---|
| PubChem CID | 162680211 |
| Molecular Formula | C20H24O4 |
| Molecular Weight | 328.41 g/mol |
| Exact Mass | 328.17 |
| IUPAC Name | (1-hydroxy-6,6,9-trimethyl-3-propylbenzo[c]chromen-2-yl)methanediol |
| SMILES | CCCc1cc2c(c(O)c1C(O)O)-c1cc(C)ccc1C(C)(C)O2 |
| InChI | InChI=1S/C20H24O4/c1-5-6-12-10-15-17(18(21)16(12)19(22)23)13-9-11(2)7-8-14(13)20(3,4)24-15/h7-10,19,21-23H,5-6H2,1-4H3 |
| InChIKey | TWFDPSQSGZPXNI-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 69.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.41 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|