C24H28N2O3 — CID 155575218
6,6,9-trimethyl-2-(3-methyl-1,2,4-oxadiazol-5-yl)-3-pentylbenzo[c]chromen-1-ol (PubChem CID 155575218) has the molecular formula C24H28N2O3 and a molecular weight of 392.50 g/mol. Its IUPAC name is 6,6,9-trimethyl-2-(3-methyl-1,2,4-oxadiazol-5-yl)-3-pentylbenzo[c]chromen-1-ol.
| Compound Name | 6,6,9-trimethyl-2-(3-methyl-1,2,4-oxadiazol-5-yl)-3-pentylbenzo[c]chromen-1-ol |
|---|---|
| PubChem CID | 155575218 |
| Molecular Formula | C24H28N2O3 |
| Molecular Weight | 392.50 g/mol |
| Exact Mass | 392.21 |
| IUPAC Name | 6,6,9-trimethyl-2-(3-methyl-1,2,4-oxadiazol-5-yl)-3-pentylbenzo[c]chromen-1-ol |
| SMILES | CCCCCc1cc2c(c(O)c1-c1nc(C)no1)-c1cc(C)ccc1C(C)(C)O2 |
| InChI | InChI=1S/C24H28N2O3/c1-6-7-8-9-16-13-19-21(22(27)20(16)23-25-15(3)26-29-23)17-12-14(2)10-11-18(17)24(4,5)28-19/h10-13,27H,6-9H2,1-5H3 |
| InChIKey | HTSMMXYOIILFAQ-UHFFFAOYSA-N |
| XLogP | 6.09 |
| TPSA | 68.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.50 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|