C25H29NO2 — CID 155575166
6,6,9-trimethyl-3-pentyl-2-(1H-pyrrol-3-yl)benzo[c]chromen-1-ol (PubChem CID 155575166) has the molecular formula C25H29NO2 and a molecular weight of 375.51 g/mol. Its IUPAC name is 6,6,9-trimethyl-3-pentyl-2-(1H-pyrrol-3-yl)benzo[c]chromen-1-ol.
| Compound Name | 6,6,9-trimethyl-3-pentyl-2-(1H-pyrrol-3-yl)benzo[c]chromen-1-ol |
|---|---|
| PubChem CID | 155575166 |
| Molecular Formula | C25H29NO2 |
| Molecular Weight | 375.51 g/mol |
| Exact Mass | 375.22 |
| IUPAC Name | 6,6,9-trimethyl-3-pentyl-2-(1H-pyrrol-3-yl)benzo[c]chromen-1-ol |
| SMILES | CCCCCc1cc2c(c(O)c1-c1cc[nH]c1)-c1cc(C)ccc1C(C)(C)O2 |
| InChI | InChI=1S/C25H29NO2/c1-5-6-7-8-17-14-21-23(24(27)22(17)18-11-12-26-15-18)19-13-16(2)9-10-20(19)25(3,4)28-21/h9-15,26-27H,5-8H2,1-4H3 |
| InChIKey | QGFVCAIFQQSEFU-UHFFFAOYSA-N |
| XLogP | 6.72 |
| TPSA | 45.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.51 |
| LogP ≤ 5 | 6.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|