C42H50O4 — CID 172869964
4-(1-hydroxy-6,6,9-trimethyl-3-pentylbenzo[c]chromen-4-yl)-6,6,9-trimethyl-3-pentylbenzo[c]chromen-1-ol (PubChem CID 172869964) has the molecular formula C42H50O4 and a molecular weight of 618.86 g/mol. Its IUPAC name is 4-(1-hydroxy-6,6,9-trimethyl-3-pentylbenzo[c]chromen-4-yl)-6,6,9-trimethyl-3-pentylbenzo[c]chromen-1-ol.
| Compound Name | 4-(1-hydroxy-6,6,9-trimethyl-3-pentylbenzo[c]chromen-4-yl)-6,6,9-trimethyl-3-pentylbenzo[c]chromen-1-ol |
|---|---|
| PubChem CID | 172869964 |
| Molecular Formula | C42H50O4 |
| Molecular Weight | 618.86 g/mol |
| Exact Mass | 618.37 |
| IUPAC Name | 4-(1-hydroxy-6,6,9-trimethyl-3-pentylbenzo[c]chromen-4-yl)-6,6,9-trimethyl-3-pentylbenzo[c]chromen-1-ol |
| SMILES | CCCCCc1cc(O)c2c(c1-c1c(CCCCC)cc(O)c3c1OC(C)(C)c1ccc(C)cc1-3)OC(C)(C)c1ccc(C)cc1-2 |
| InChI | InChI=1S/C42H50O4/c1-9-11-13-15-27-23-33(43)37-29-21-25(3)17-19-31(29)41(5,6)45-39(37)35(27)36-28(16-14-12-10-2)24-34(44)38-30-22-26(4)18-20-32(30)42(7,8)46-40(36)38/h17-24,43-44H,9-16H2,1-8H3 |
| InChIKey | QRJOXYWNXSPRJQ-UHFFFAOYSA-N |
| XLogP | 11.44 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 618.86 |
| LogP ≤ 5 | 11.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|