C34H36O7 — CID 155575258
methyl 4-[8,8,11-trimethyl-4-oxo-2-(2-oxopropyl)-5-pentylisochromeno[3,4-h][1,3]benzodioxin-2-yl]benzoate (PubChem CID 155575258) has the molecular formula C34H36O7 and a molecular weight of 556.66 g/mol. Its IUPAC name is methyl 4-[8,8,11-trimethyl-4-oxo-2-(2-oxopropyl)-5-pentylisochromeno[3,4-h][1,3]benzodioxin-2-yl]benzoate.
| Compound Name | methyl 4-[8,8,11-trimethyl-4-oxo-2-(2-oxopropyl)-5-pentylisochromeno[3,4-h][1,3]benzodioxin-2-yl]benzoate |
|---|---|
| PubChem CID | 155575258 |
| Molecular Formula | C34H36O7 |
| Molecular Weight | 556.66 g/mol |
| Exact Mass | 556.25 |
| IUPAC Name | methyl 4-[8,8,11-trimethyl-4-oxo-2-(2-oxopropyl)-5-pentylisochromeno[3,4-h][1,3]benzodioxin-2-yl]benzoate |
| SMILES | CCCCCc1cc2c(c3c1C(=O)OC(CC(C)=O)(c1ccc(C(=O)OC)cc1)O3)-c1cc(C)ccc1C(C)(C)O2 |
| InChI | InChI=1S/C34H36O7/c1-7-8-9-10-23-18-27-29(25-17-20(2)11-16-26(25)33(4,5)39-27)30-28(23)32(37)41-34(40-30,19-21(3)35)24-14-12-22(13-15-24)31(36)38-6/h11-18H,7-10,19H2,1-6H3 |
| InChIKey | GSDIRIPPNDIZMT-UHFFFAOYSA-N |
| XLogP | 7.19 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.66 |
| LogP ≤ 5 | 7.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|