C32H37ClO5 — CID 155575256
(8aR,12aR)-2-(4-chlorophenyl)-8,8,11-trimethyl-2-(2-oxopropyl)-5-pentyl-8a,9,10,12a-tetrahydroisochromeno[3,4-h][1,3]benzodioxin-4-one (PubChem CID 155575256) has the molecular formula C32H37ClO5 and a molecular weight of 537.10 g/mol. Its IUPAC name is (8aR,12aR)-2-(4-chlorophenyl)-8,8,11-trimethyl-2-(2-oxopropyl)-5-pentyl-8a,9,10,12a-tetrahydroisochromeno[3,4-h][1,3]benzodioxin-4-one.
| Compound Name | (8aR,12aR)-2-(4-chlorophenyl)-8,8,11-trimethyl-2-(2-oxopropyl)-5-pentyl-8a,9,10,12a-tetrahydroisochromeno[3,4-h][1,3]benzodioxin-4-one |
|---|---|
| PubChem CID | 155575256 |
| Molecular Formula | C32H37ClO5 |
| Molecular Weight | 537.10 g/mol |
| Exact Mass | 536.23 |
| IUPAC Name | (8aR,12aR)-2-(4-chlorophenyl)-8,8,11-trimethyl-2-(2-oxopropyl)-5-pentyl-8a,9,10,12a-tetrahydroisochromeno[3,4-h][1,3]benzodioxin-4-one |
| SMILES | CCCCCc1cc2c(c3c1C(=O)OC(CC(C)=O)(c1ccc(Cl)cc1)O3)[C@@H]1C=C(C)CC[C@H]1C(C)(C)O2 |
| InChI | InChI=1S/C32H37ClO5/c1-6-7-8-9-21-17-26-28(24-16-19(2)10-15-25(24)31(4,5)36-26)29-27(21)30(35)38-32(37-29,18-20(3)34)22-11-13-23(33)14-12-22/h11-14,16-17,24-25H,6-10,15,18H2,1-5H3/t24-,25-,32?/m1/s1 |
| InChIKey | ZFFHXDSBLRWMRM-GSVKASDMSA-N |
| XLogP | 8.06 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.10 |
| LogP ≤ 5 | 8.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|