C24H34O4Si — CID 172549691
(8aR,12aR)-2,2,8,8,11-pentamethyl-5-pentyl-8a,9,10,12a-tetrahydroisochromeno[3,4-h][1,3,2]benzodioxasilin-4-one (PubChem CID 172549691) has the molecular formula C24H34O4Si and a molecular weight of 414.62 g/mol. Its IUPAC name is (8aR,12aR)-2,2,8,8,11-pentamethyl-5-pentyl-8a,9,10,12a-tetrahydroisochromeno[3,4-h][1,3,2]benzodioxasilin-4-one.
| Compound Name | (8aR,12aR)-2,2,8,8,11-pentamethyl-5-pentyl-8a,9,10,12a-tetrahydroisochromeno[3,4-h][1,3,2]benzodioxasilin-4-one |
|---|---|
| PubChem CID | 172549691 |
| Molecular Formula | C24H34O4Si |
| Molecular Weight | 414.62 g/mol |
| Exact Mass | 414.22 |
| IUPAC Name | (8aR,12aR)-2,2,8,8,11-pentamethyl-5-pentyl-8a,9,10,12a-tetrahydroisochromeno[3,4-h][1,3,2]benzodioxasilin-4-one |
| SMILES | CCCCCc1cc2c(c3c1C(=O)O[Si](C)(C)O3)[C@@H]1C=C(C)CC[C@H]1C(C)(C)O2 |
| InChI | InChI=1S/C24H34O4Si/c1-7-8-9-10-16-14-19-21(22-20(16)23(25)28-29(5,6)27-22)17-13-15(2)11-12-18(17)24(3,4)26-19/h13-14,17-18H,7-12H2,1-6H3/t17-,18-/m1/s1 |
| InChIKey | MJZBTPYBPNVSNM-QZTJIDSGSA-N |
| XLogP | 6.28 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.62 |
| LogP ≤ 5 | 6.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|