C23H32O4 — CID 165154604
trideuteriomethyl (6aR,10aR)-1-hydroxy-6,6,9-trimethyl-3-pentyl-6a,7,8,10a-tetrahydrobenzo[c]chromene-2-carboxylate (PubChem CID 165154604) has the molecular formula C23H32O4 and a molecular weight of 375.52 g/mol. Its IUPAC name is trideuteriomethyl (6aR,10aR)-1-hydroxy-6,6,9-trimethyl-3-pentyl-6a,7,8,10a-tetrahydrobenzo[c]chromene-2-carboxylate.
| Compound Name | trideuteriomethyl (6aR,10aR)-1-hydroxy-6,6,9-trimethyl-3-pentyl-6a,7,8,10a-tetrahydrobenzo[c]chromene-2-carboxylate |
|---|---|
| PubChem CID | 165154604 |
| Molecular Formula | C23H32O4 |
| Molecular Weight | 375.52 g/mol |
| Exact Mass | 375.25 |
| IUPAC Name | trideuteriomethyl (6aR,10aR)-1-hydroxy-6,6,9-trimethyl-3-pentyl-6a,7,8,10a-tetrahydrobenzo[c]chromene-2-carboxylate |
| SMILES | [2H]C([2H])([2H])OC(=O)c1c(CCCCC)cc2c(c1O)[C@@H]1C=C(C)CC[C@H]1C(C)(C)O2 |
| InChI | InChI=1S/C23H32O4/c1-6-7-8-9-15-13-18-20(21(24)19(15)22(25)26-5)16-12-14(2)10-11-17(16)23(3,4)27-18/h12-13,16-17,24H,6-11H2,1-5H3/t16-,17-/m1/s1/i5D3 |
| InChIKey | PZGQMCZVNQZFFP-ILIQRJFASA-N |
| XLogP | 5.52 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.52 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|