C21H29BrO2 — CID 155575209
2-bromo-6,6,9-trimethyl-3-pentyl-6a,7,8,10a-tetrahydrobenzo[c]chromen-1-ol (PubChem CID 155575209) has the molecular formula C21H29BrO2 and a molecular weight of 393.37 g/mol. Its IUPAC name is 2-bromo-6,6,9-trimethyl-3-pentyl-6a,7,8,10a-tetrahydrobenzo[c]chromen-1-ol.
| Compound Name | 2-bromo-6,6,9-trimethyl-3-pentyl-6a,7,8,10a-tetrahydrobenzo[c]chromen-1-ol |
|---|---|
| PubChem CID | 155575209 |
| Molecular Formula | C21H29BrO2 |
| Molecular Weight | 393.37 g/mol |
| Exact Mass | 392.14 |
| IUPAC Name | 2-bromo-6,6,9-trimethyl-3-pentyl-6a,7,8,10a-tetrahydrobenzo[c]chromen-1-ol |
| SMILES | CCCCCc1cc2c(c(O)c1Br)C1C=C(C)CCC1C(C)(C)O2 |
| InChI | InChI=1S/C21H29BrO2/c1-5-6-7-8-14-12-17-18(20(23)19(14)22)15-11-13(2)9-10-16(15)21(3,4)24-17/h11-12,15-16,23H,5-10H2,1-4H3 |
| InChIKey | IRSVNXDXCLUGHD-UHFFFAOYSA-N |
| XLogP | 6.50 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.37 |
| LogP ≤ 5 | 6.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|