C21H28Br2O2 — CID 15378176
(6aR,10aR)-2,4-dibromo-6,6,9-trimethyl-3-pentyl-6a,7,8,10a-tetrahydrobenzo[c]chromen-1-ol (PubChem CID 15378176) has the molecular formula C21H28Br2O2 and a molecular weight of 472.26 g/mol. Its IUPAC name is (6aR,10aR)-2,4-dibromo-6,6,9-trimethyl-3-pentyl-6a,7,8,10a-tetrahydrobenzo[c]chromen-1-ol.
| Compound Name | (6aR,10aR)-2,4-dibromo-6,6,9-trimethyl-3-pentyl-6a,7,8,10a-tetrahydrobenzo[c]chromen-1-ol |
|---|---|
| PubChem CID | 15378176 |
| Molecular Formula | C21H28Br2O2 |
| Molecular Weight | 472.26 g/mol |
| Exact Mass | 470.05 |
| IUPAC Name | (6aR,10aR)-2,4-dibromo-6,6,9-trimethyl-3-pentyl-6a,7,8,10a-tetrahydrobenzo[c]chromen-1-ol |
| SMILES | CCCCCc1c(Br)c(O)c2c(c1Br)OC(C)(C)[C@@H]1CCC(C)=C[C@@H]21 |
| InChI | InChI=1S/C21H28Br2O2/c1-5-6-7-8-13-17(22)19(24)16-14-11-12(2)9-10-15(14)21(3,4)25-20(16)18(13)23/h11,14-15,24H,5-10H2,1-4H3/t14-,15-/m1/s1 |
| InChIKey | ODCDPJNIRKBOPC-HUUCEWRRSA-N |
| XLogP | 7.26 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.26 |
| LogP ≤ 5 | 7.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|