C25H34O4 — CID 164848700
2,2,8,8,11-pentamethyl-5-pentyl-8a,9,10,12a-tetrahydroisochromeno[3,4-h][1,3]benzodioxin-4-one (PubChem CID 164848700) has the molecular formula C25H34O4 and a molecular weight of 398.54 g/mol. Its IUPAC name is 2,2,8,8,11-pentamethyl-5-pentyl-8a,9,10,12a-tetrahydroisochromeno[3,4-h][1,3]benzodioxin-4-one.
| Compound Name | 2,2,8,8,11-pentamethyl-5-pentyl-8a,9,10,12a-tetrahydroisochromeno[3,4-h][1,3]benzodioxin-4-one |
|---|---|
| PubChem CID | 164848700 |
| Molecular Formula | C25H34O4 |
| Molecular Weight | 398.54 g/mol |
| Exact Mass | 398.25 |
| IUPAC Name | 2,2,8,8,11-pentamethyl-5-pentyl-8a,9,10,12a-tetrahydroisochromeno[3,4-h][1,3]benzodioxin-4-one |
| SMILES | CCCCCc1cc2c(c3c1C(=O)OC(C)(C)O3)C1C=C(C)CCC1C(C)(C)O2 |
| InChI | InChI=1S/C25H34O4/c1-7-8-9-10-16-14-19-21(22-20(16)23(26)29-25(5,6)28-22)17-13-15(2)11-12-18(17)24(3,4)27-19/h13-14,17-18H,7-12H2,1-6H3 |
| InChIKey | UTISXLILOPLANJ-UHFFFAOYSA-N |
| XLogP | 6.32 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.54 |
| LogP ≤ 5 | 6.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|