C32H37NO2 — CID 161482589
6,6,9-trimethyl-3-pentyl-2-(4-pyridin-3-ylphenyl)-6a,7,8,10a-tetrahydrobenzo[c]chromen-1-ol (PubChem CID 161482589) has the molecular formula C32H37NO2 and a molecular weight of 467.65 g/mol. Its IUPAC name is 6,6,9-trimethyl-3-pentyl-2-(4-pyridin-3-ylphenyl)-6a,7,8,10a-tetrahydrobenzo[c]chromen-1-ol.
| Compound Name | 6,6,9-trimethyl-3-pentyl-2-(4-pyridin-3-ylphenyl)-6a,7,8,10a-tetrahydrobenzo[c]chromen-1-ol |
|---|---|
| PubChem CID | 161482589 |
| Molecular Formula | C32H37NO2 |
| Molecular Weight | 467.65 g/mol |
| Exact Mass | 467.28 |
| IUPAC Name | 6,6,9-trimethyl-3-pentyl-2-(4-pyridin-3-ylphenyl)-6a,7,8,10a-tetrahydrobenzo[c]chromen-1-ol |
| SMILES | CCCCCc1cc2c(c(O)c1-c1ccc(-c3cccnc3)cc1)C1C=C(C)CCC1C(C)(C)O2 |
| InChI | InChI=1S/C32H37NO2/c1-5-6-7-9-24-19-28-30(26-18-21(2)11-16-27(26)32(3,4)35-28)31(34)29(24)23-14-12-22(13-15-23)25-10-8-17-33-20-25/h8,10,12-15,17-20,26-27,34H,5-7,9,11,16H2,1-4H3 |
| InChIKey | WEOHFESZAXYGRQ-UHFFFAOYSA-N |
| XLogP | 8.46 |
| TPSA | 42.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.65 |
| LogP ≤ 5 | 8.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|