C23H29NO2 — CID 155575356
2-(3-methylcyclohex-2-en-1-yl)-5-pentyl-4-pyridin-3-ylbenzene-1,3-diol (PubChem CID 155575356) has the molecular formula C23H29NO2 and a molecular weight of 351.49 g/mol. Its IUPAC name is 2-(3-methylcyclohex-2-en-1-yl)-5-pentyl-4-pyridin-3-ylbenzene-1,3-diol.
| Compound Name | 2-(3-methylcyclohex-2-en-1-yl)-5-pentyl-4-pyridin-3-ylbenzene-1,3-diol |
|---|---|
| PubChem CID | 155575356 |
| Molecular Formula | C23H29NO2 |
| Molecular Weight | 351.49 g/mol |
| Exact Mass | 351.22 |
| IUPAC Name | 2-(3-methylcyclohex-2-en-1-yl)-5-pentyl-4-pyridin-3-ylbenzene-1,3-diol |
| SMILES | CCCCCc1cc(O)c(C2C=C(C)CCC2)c(O)c1-c1cccnc1 |
| InChI | InChI=1S/C23H29NO2/c1-3-4-5-9-18-14-20(25)22(17-10-6-8-16(2)13-17)23(26)21(18)19-11-7-12-24-15-19/h7,11-15,17,25-26H,3-6,8-10H2,1-2H3 |
| InChIKey | WZEJRHNCJYKQDX-UHFFFAOYSA-N |
| XLogP | 6.11 |
| TPSA | 53.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.49 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|