C21H28N2O2 — CID 155575440
2-(3-methylcyclohex-2-en-1-yl)-5-pentyl-4-(1H-pyrazol-5-yl)benzene-1,3-diol (PubChem CID 155575440) has the molecular formula C21H28N2O2 and a molecular weight of 340.47 g/mol. Its IUPAC name is 2-(3-methylcyclohex-2-en-1-yl)-5-pentyl-4-(1H-pyrazol-5-yl)benzene-1,3-diol.
| Compound Name | 2-(3-methylcyclohex-2-en-1-yl)-5-pentyl-4-(1H-pyrazol-5-yl)benzene-1,3-diol |
|---|---|
| PubChem CID | 155575440 |
| Molecular Formula | C21H28N2O2 |
| Molecular Weight | 340.47 g/mol |
| Exact Mass | 340.22 |
| IUPAC Name | 2-(3-methylcyclohex-2-en-1-yl)-5-pentyl-4-(1H-pyrazol-5-yl)benzene-1,3-diol |
| SMILES | CCCCCc1cc(O)c(C2C=C(C)CCC2)c(O)c1-c1ccn[nH]1 |
| InChI | InChI=1S/C21H28N2O2/c1-3-4-5-8-16-13-18(24)20(15-9-6-7-14(2)12-15)21(25)19(16)17-10-11-22-23-17/h10-13,15,24-25H,3-9H2,1-2H3,(H,22,23) |
| InChIKey | LVPWVNOUEGRLKJ-UHFFFAOYSA-N |
| XLogP | 5.43 |
| TPSA | 69.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.47 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|