C21H32O2 — CID 153373533
4-[(1S)-3-methylcyclohex-2-en-1-yl]-5-pentylbenzene-1,3-diol;prop-1-ene (PubChem CID 153373533) has the molecular formula C21H32O2 and a molecular weight of 316.49 g/mol. Its IUPAC name is 4-[(1S)-3-methylcyclohex-2-en-1-yl]-5-pentylbenzene-1,3-diol;prop-1-ene.
| Compound Name | 4-[(1S)-3-methylcyclohex-2-en-1-yl]-5-pentylbenzene-1,3-diol;prop-1-ene |
|---|---|
| PubChem CID | 153373533 |
| Molecular Formula | C21H32O2 |
| Molecular Weight | 316.49 g/mol |
| Exact Mass | 316.24 |
| IUPAC Name | 4-[(1S)-3-methylcyclohex-2-en-1-yl]-5-pentylbenzene-1,3-diol;prop-1-ene |
| SMILES | C=CC.CCCCCc1cc(O)cc(O)c1[C@@H]1C=C(C)CCC1 |
| InChI | InChI=1S/C18H26O2.C3H6/c1-3-4-5-8-15-11-16(19)12-17(20)18(15)14-9-6-7-13(2)10-14;1-3-2/h10-12,14,19-20H,3-9H2,1-2H3;3H,1H2,2H3/t14-;/m0./s1 |
| InChIKey | MZROAQHMMYDYPV-UQKRIMTDSA-N |
| XLogP | 6.24 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.49 |
| LogP ≤ 5 | 6.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|