C38H53NO7 — CID 167689119
2,4-dihydroxy-3-(3-methylcyclohex-2-en-1-yl)-6-pentylbenzamide;2,4-dihydroxy-3-(3-methylcyclohex-2-en-1-yl)-6-pentylbenzoic acid (PubChem CID 167689119) has the molecular formula C38H53NO7 and a molecular weight of 635.84 g/mol. Its IUPAC name is 2,4-dihydroxy-3-(3-methylcyclohex-2-en-1-yl)-6-pentylbenzamide;2,4-dihydroxy-3-(3-methylcyclohex-2-en-1-yl)-6-pentylbenzoic acid.
| Compound Name | 2,4-dihydroxy-3-(3-methylcyclohex-2-en-1-yl)-6-pentylbenzamide;2,4-dihydroxy-3-(3-methylcyclohex-2-en-1-yl)-6-pentylbenzoic acid |
|---|---|
| PubChem CID | 167689119 |
| Molecular Formula | C38H53NO7 |
| Molecular Weight | 635.84 g/mol |
| Exact Mass | 635.38 |
| IUPAC Name | 2,4-dihydroxy-3-(3-methylcyclohex-2-en-1-yl)-6-pentylbenzamide;2,4-dihydroxy-3-(3-methylcyclohex-2-en-1-yl)-6-pentylbenzoic acid |
| SMILES | CCCCCc1cc(O)c(C2C=C(C)CCC2)c(O)c1C(=O)O.CCCCCc1cc(O)c(C2C=C(C)CCC2)c(O)c1C(N)=O |
| InChI | InChI=1S/C19H27NO3.C19H26O4/c1-3-4-5-8-14-11-15(21)16(18(22)17(14)19(20)23)13-9-6-7-12(2)10-13;1-3-4-5-8-14-11-15(20)16(18(21)17(14)19(22)23)13-9-6-7-12(2)10-13/h10-11,13,21-22H,3-9H2,1-2H3,(H2,20,23);10-11,13,20-21H,3-9H2,1-2H3,(H,22,23) |
| InChIKey | WQVUJJKLVIOTQE-UHFFFAOYSA-N |
| XLogP | 8.89 |
| TPSA | 161.31 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 46 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 635.84 |
| LogP ≤ 5 | 8.89 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|