C48H72N2O7 — CID 167656101
cyclopentanamine;N-cyclopentyl-2,4-dihydroxy-3-(3-methylcyclohex-2-en-1-yl)-6-pentylbenzamide;2,4-dihydroxy-3-(3-methylcyclohex-2-en-1-yl)-6-pentylbenzoic acid (PubChem CID 167656101) has the molecular formula C48H72N2O7 and a molecular weight of 789.11 g/mol. Its IUPAC name is cyclopentanamine;N-cyclopentyl-2,4-dihydroxy-3-(3-methylcyclohex-2-en-1-yl)-6-pentylbenzamide;2,4-dihydroxy-3-(3-methylcyclohex-2-en-1-yl)-6-pentylbenzoic acid.
| Compound Name | cyclopentanamine;N-cyclopentyl-2,4-dihydroxy-3-(3-methylcyclohex-2-en-1-yl)-6-pentylbenzamide;2,4-dihydroxy-3-(3-methylcyclohex-2-en-1-yl)-6-pentylbenzoic acid |
|---|---|
| PubChem CID | 167656101 |
| Molecular Formula | C48H72N2O7 |
| Molecular Weight | 789.11 g/mol |
| Exact Mass | 788.53 |
| IUPAC Name | cyclopentanamine;N-cyclopentyl-2,4-dihydroxy-3-(3-methylcyclohex-2-en-1-yl)-6-pentylbenzamide;2,4-dihydroxy-3-(3-methylcyclohex-2-en-1-yl)-6-pentylbenzoic acid |
| SMILES | CCCCCc1cc(O)c(C2C=C(C)CCC2)c(O)c1C(=O)NC1CCCC1.CCCCCc1cc(O)c(C2C=C(C)CCC2)c(O)c1C(=O)O.NC1CCCC1 |
| InChI | InChI=1S/C24H35NO3.C19H26O4.C5H11N/c1-3-4-5-10-18-15-20(26)21(17-11-8-9-16(2)14-17)23(27)22(18)24(28)25-19-12-6-7-13-19;1-3-4-5-8-14-11-15(20)16(18(21)17(14)19(22)23)13-9-6-7-12(2)10-13;6-5-3-1-2-4-5/h14-15,17,19,26-27H,3-13H2,1-2H3,(H,25,28);10-11,13,20-21H,3-9H2,1-2H3,(H,22,23);5H,1-4,6H2 |
| InChIKey | RGWQYEWLQKHVHD-UHFFFAOYSA-N |
| XLogP | 11.35 |
| TPSA | 173.34 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 57 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 789.11 |
| LogP ≤ 5 | 11.35 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|