C21H28O4 — CID 155570367
4-ethenoxy-2-hydroxy-3-[(1S)-3-methylcyclohex-2-en-1-yl]-6-pentylbenzoic acid (PubChem CID 155570367) has the molecular formula C21H28O4 and a molecular weight of 344.45 g/mol. Its IUPAC name is 4-ethenoxy-2-hydroxy-3-[(1S)-3-methylcyclohex-2-en-1-yl]-6-pentylbenzoic acid.
| Compound Name | 4-ethenoxy-2-hydroxy-3-[(1S)-3-methylcyclohex-2-en-1-yl]-6-pentylbenzoic acid |
|---|---|
| PubChem CID | 155570367 |
| Molecular Formula | C21H28O4 |
| Molecular Weight | 344.45 g/mol |
| Exact Mass | 344.20 |
| IUPAC Name | 4-ethenoxy-2-hydroxy-3-[(1S)-3-methylcyclohex-2-en-1-yl]-6-pentylbenzoic acid |
| SMILES | C=COc1cc(CCCCC)c(C(=O)O)c(O)c1[C@@H]1C=C(C)CCC1 |
| InChI | InChI=1S/C21H28O4/c1-4-6-7-10-16-13-17(25-5-2)18(20(22)19(16)21(23)24)15-11-8-9-14(3)12-15/h5,12-13,15,22H,2,4,6-11H2,1,3H3,(H,23,24)/t15-/m0/s1 |
| InChIKey | BWNNBEZDJWOEEL-HNNXBMFYSA-N |
| XLogP | 5.56 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.45 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|