C24H37NO4 — CID 158233633
carbanide;[4-carboxy-3-hydroxy-2-(3-methyl-6-prop-1-en-2-ylcyclohex-2-en-1-yl)-5-pentylphenoxy]methylazanium (PubChem CID 158233633) has the molecular formula C24H37NO4 and a molecular weight of 403.56 g/mol. Its IUPAC name is carbanide;[4-carboxy-3-hydroxy-2-(3-methyl-6-prop-1-en-2-ylcyclohex-2-en-1-yl)-5-pentylphenoxy]methylazanium.
| Compound Name | carbanide;[4-carboxy-3-hydroxy-2-(3-methyl-6-prop-1-en-2-ylcyclohex-2-en-1-yl)-5-pentylphenoxy]methylazanium |
|---|---|
| PubChem CID | 158233633 |
| Molecular Formula | C24H37NO4 |
| Molecular Weight | 403.56 g/mol |
| Exact Mass | 403.27 |
| IUPAC Name | carbanide;[4-carboxy-3-hydroxy-2-(3-methyl-6-prop-1-en-2-ylcyclohex-2-en-1-yl)-5-pentylphenoxy]methylazanium |
| SMILES | C=C(C)C1CCC(C)=CC1c1c(OC[NH3+])cc(CCCCC)c(C(=O)O)c1O.[CH3-] |
| InChI | InChI=1S/C23H33NO4.CH3/c1-5-6-7-8-16-12-19(28-13-24)21(22(25)20(16)23(26)27)18-11-15(4)9-10-17(18)14(2)3;/h11-12,17-18,25H,2,5-10,13,24H2,1,3-4H3,(H,26,27);1H3/q;-1/p+1 |
| InChIKey | GEROVWXFNCAUOA-UHFFFAOYSA-O |
| XLogP | 4.87 |
| TPSA | 94.40 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.56 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|