C29H40O6 — CID 135226534
2-hydroxy-3-(3-methyl-6-prop-1-en-2-ylcyclohex-2-en-1-yl)-6-pentyl-4-[2-(2-prop-2-ynoxyethoxy)ethoxy]benzoic acid (PubChem CID 135226534) has the molecular formula C29H40O6 and a molecular weight of 484.63 g/mol. Its IUPAC name is 2-hydroxy-3-(3-methyl-6-prop-1-en-2-ylcyclohex-2-en-1-yl)-6-pentyl-4-[2-(2-prop-2-ynoxyethoxy)ethoxy]benzoic acid.
| Compound Name | 2-hydroxy-3-(3-methyl-6-prop-1-en-2-ylcyclohex-2-en-1-yl)-6-pentyl-4-[2-(2-prop-2-ynoxyethoxy)ethoxy]benzoic acid |
|---|---|
| PubChem CID | 135226534 |
| Molecular Formula | C29H40O6 |
| Molecular Weight | 484.63 g/mol |
| Exact Mass | 484.28 |
| IUPAC Name | 2-hydroxy-3-(3-methyl-6-prop-1-en-2-ylcyclohex-2-en-1-yl)-6-pentyl-4-[2-(2-prop-2-ynoxyethoxy)ethoxy]benzoic acid |
| SMILES | C#CCOCCOCCOc1cc(CCCCC)c(C(=O)O)c(O)c1C1C=C(C)CCC1C(=C)C |
| InChI | InChI=1S/C29H40O6/c1-6-8-9-10-22-19-25(35-17-16-34-15-14-33-13-7-2)27(28(30)26(22)29(31)32)24-18-21(5)11-12-23(24)20(3)4/h2,18-19,23-24,30H,3,6,8-17H2,1,4-5H3,(H,31,32) |
| InChIKey | ZZPPBBTUFXWYIH-UHFFFAOYSA-N |
| XLogP | 5.88 |
| TPSA | 85.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.63 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|