C29H45NO4 — CID 166826242
2,4-dihydroxy-3-(3-methyl-6-prop-1-en-2-ylcyclohex-2-en-1-yl)-6-pentyl-N-(4-propoxybutyl)benzamide (PubChem CID 166826242) has the molecular formula C29H45NO4 and a molecular weight of 471.68 g/mol. Its IUPAC name is 2,4-dihydroxy-3-(3-methyl-6-prop-1-en-2-ylcyclohex-2-en-1-yl)-6-pentyl-N-(4-propoxybutyl)benzamide.
| Compound Name | 2,4-dihydroxy-3-(3-methyl-6-prop-1-en-2-ylcyclohex-2-en-1-yl)-6-pentyl-N-(4-propoxybutyl)benzamide |
|---|---|
| PubChem CID | 166826242 |
| Molecular Formula | C29H45NO4 |
| Molecular Weight | 471.68 g/mol |
| Exact Mass | 471.33 |
| IUPAC Name | 2,4-dihydroxy-3-(3-methyl-6-prop-1-en-2-ylcyclohex-2-en-1-yl)-6-pentyl-N-(4-propoxybutyl)benzamide |
| SMILES | C=C(C)C1CCC(C)=CC1c1c(O)cc(CCCCC)c(C(=O)NCCCCOCCC)c1O |
| InChI | InChI=1S/C29H45NO4/c1-6-8-9-12-22-19-25(31)27(24-18-21(5)13-14-23(24)20(3)4)28(32)26(22)29(33)30-15-10-11-17-34-16-7-2/h18-19,23-24,31-32H,3,6-17H2,1-2,4-5H3,(H,30,33) |
| InChIKey | QFXVYZHWSSFILJ-UHFFFAOYSA-N |
| XLogP | 6.78 |
| TPSA | 78.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.68 |
| LogP ≤ 5 | 6.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|