C22H29IO4 — CID 163592717
methyl 2,4-dihydroxy-6-(4-iodobutyl)-3-[(1R,6R)-3-methyl-6-prop-1-en-2-ylcyclohex-2-en-1-yl]benzoate (PubChem CID 163592717) has the molecular formula C22H29IO4 and a molecular weight of 484.37 g/mol. Its IUPAC name is methyl 2,4-dihydroxy-6-(4-iodobutyl)-3-[(1R,6R)-3-methyl-6-prop-1-en-2-ylcyclohex-2-en-1-yl]benzoate.
| Compound Name | methyl 2,4-dihydroxy-6-(4-iodobutyl)-3-[(1R,6R)-3-methyl-6-prop-1-en-2-ylcyclohex-2-en-1-yl]benzoate |
|---|---|
| PubChem CID | 163592717 |
| Molecular Formula | C22H29IO4 |
| Molecular Weight | 484.37 g/mol |
| Exact Mass | 484.11 |
| IUPAC Name | methyl 2,4-dihydroxy-6-(4-iodobutyl)-3-[(1R,6R)-3-methyl-6-prop-1-en-2-ylcyclohex-2-en-1-yl]benzoate |
| SMILES | C=C(C)[C@@H]1CCC(C)=C[C@H]1c1c(O)cc(CCCCI)c(C(=O)OC)c1O |
| InChI | InChI=1S/C22H29IO4/c1-13(2)16-9-8-14(3)11-17(16)20-18(24)12-15(7-5-6-10-23)19(21(20)25)22(26)27-4/h11-12,16-17,24-25H,1,5-10H2,2-4H3/t16-,17+/m0/s1 |
| InChIKey | GQVJSIDHVNMNBG-DLBZAZTESA-N |
| XLogP | 5.66 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.37 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|