C29H42O8 — CID 134535240
4-[2-[2-(2-carboxyethoxy)ethoxy]ethoxy]-2-hydroxy-3-(3-methyl-6-prop-1-en-2-ylcyclohex-2-en-1-yl)-6-pentylbenzoic acid (PubChem CID 134535240) has the molecular formula C29H42O8 and a molecular weight of 518.65 g/mol. Its IUPAC name is 4-[2-[2-(2-carboxyethoxy)ethoxy]ethoxy]-2-hydroxy-3-(3-methyl-6-prop-1-en-2-ylcyclohex-2-en-1-yl)-6-pentylbenzoic acid.
| Compound Name | 4-[2-[2-(2-carboxyethoxy)ethoxy]ethoxy]-2-hydroxy-3-(3-methyl-6-prop-1-en-2-ylcyclohex-2-en-1-yl)-6-pentylbenzoic acid |
|---|---|
| PubChem CID | 134535240 |
| Molecular Formula | C29H42O8 |
| Molecular Weight | 518.65 g/mol |
| Exact Mass | 518.29 |
| IUPAC Name | 4-[2-[2-(2-carboxyethoxy)ethoxy]ethoxy]-2-hydroxy-3-(3-methyl-6-prop-1-en-2-ylcyclohex-2-en-1-yl)-6-pentylbenzoic acid |
| SMILES | C=C(C)C1CCC(C)=CC1c1c(OCCOCCOCCC(=O)O)cc(CCCCC)c(C(=O)O)c1O |
| InChI | InChI=1S/C29H42O8/c1-5-6-7-8-21-18-24(37-16-15-36-14-13-35-12-11-25(30)31)27(28(32)26(21)29(33)34)23-17-20(4)9-10-22(23)19(2)3/h17-18,22-23,32H,2,5-16H2,1,3-4H3,(H,30,31)(H,33,34) |
| InChIKey | REZOCONVJRPANK-UHFFFAOYSA-N |
| XLogP | 5.73 |
| TPSA | 122.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.65 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|