C26H38O5 — CID 135230955
4-(2-ethoxyethoxy)-2-hydroxy-3-(3-methyl-6-prop-1-en-2-ylcyclohex-2-en-1-yl)-6-pentylbenzoic acid (PubChem CID 135230955) has the molecular formula C26H38O5 and a molecular weight of 430.59 g/mol. Its IUPAC name is 4-(2-ethoxyethoxy)-2-hydroxy-3-(3-methyl-6-prop-1-en-2-ylcyclohex-2-en-1-yl)-6-pentylbenzoic acid.
| Compound Name | 4-(2-ethoxyethoxy)-2-hydroxy-3-(3-methyl-6-prop-1-en-2-ylcyclohex-2-en-1-yl)-6-pentylbenzoic acid |
|---|---|
| PubChem CID | 135230955 |
| Molecular Formula | C26H38O5 |
| Molecular Weight | 430.59 g/mol |
| Exact Mass | 430.27 |
| IUPAC Name | 4-(2-ethoxyethoxy)-2-hydroxy-3-(3-methyl-6-prop-1-en-2-ylcyclohex-2-en-1-yl)-6-pentylbenzoic acid |
| SMILES | C=C(C)C1CCC(C)=CC1c1c(OCCOCC)cc(CCCCC)c(C(=O)O)c1O |
| InChI | InChI=1S/C26H38O5/c1-6-8-9-10-19-16-22(31-14-13-30-7-2)24(25(27)23(19)26(28)29)21-15-18(5)11-12-20(21)17(3)4/h15-16,20-21,27H,3,6-14H2,1-2,4-5H3,(H,28,29) |
| InChIKey | IFNWMCPJMZCZAV-UHFFFAOYSA-N |
| XLogP | 6.25 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.59 |
| LogP ≤ 5 | 6.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|