C30H45BrO7 — CID 135226536
4-[2-[2-[2-(2-bromoethoxy)ethoxy]ethoxy]ethoxy]-2-hydroxy-3-(3-methyl-6-prop-1-en-2-ylcyclohex-2-en-1-yl)-6-pentylbenzoic acid (PubChem CID 135226536) has the molecular formula C30H45BrO7 and a molecular weight of 597.59 g/mol. Its IUPAC name is 4-[2-[2-[2-(2-bromoethoxy)ethoxy]ethoxy]ethoxy]-2-hydroxy-3-(3-methyl-6-prop-1-en-2-ylcyclohex-2-en-1-yl)-6-pentylbenzoic acid.
| Compound Name | 4-[2-[2-[2-(2-bromoethoxy)ethoxy]ethoxy]ethoxy]-2-hydroxy-3-(3-methyl-6-prop-1-en-2-ylcyclohex-2-en-1-yl)-6-pentylbenzoic acid |
|---|---|
| PubChem CID | 135226536 |
| Molecular Formula | C30H45BrO7 |
| Molecular Weight | 597.59 g/mol |
| Exact Mass | 596.23 |
| IUPAC Name | 4-[2-[2-[2-(2-bromoethoxy)ethoxy]ethoxy]ethoxy]-2-hydroxy-3-(3-methyl-6-prop-1-en-2-ylcyclohex-2-en-1-yl)-6-pentylbenzoic acid |
| SMILES | C=C(C)C1CCC(C)=CC1c1c(OCCOCCOCCOCCBr)cc(CCCCC)c(C(=O)O)c1O |
| InChI | InChI=1S/C30H45BrO7/c1-5-6-7-8-23-20-26(38-18-17-37-16-15-36-14-13-35-12-11-31)28(29(32)27(23)30(33)34)25-19-22(4)9-10-24(25)21(2)3/h19-20,24-25,32H,2,5-18H2,1,3-4H3,(H,33,34) |
| InChIKey | MOMJQGFHOHUIJC-UHFFFAOYSA-N |
| XLogP | 6.66 |
| TPSA | 94.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 597.59 |
| LogP ≤ 5 | 6.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|