C19H28O4S — CID 155576080
2-(3-methylcyclohex-2-en-1-yl)-4-methylsulfonyl-5-pentylbenzene-1,3-diol (PubChem CID 155576080) has the molecular formula C19H28O4S and a molecular weight of 352.50 g/mol. Its IUPAC name is 2-(3-methylcyclohex-2-en-1-yl)-4-methylsulfonyl-5-pentylbenzene-1,3-diol.
| Compound Name | 2-(3-methylcyclohex-2-en-1-yl)-4-methylsulfonyl-5-pentylbenzene-1,3-diol |
|---|---|
| PubChem CID | 155576080 |
| Molecular Formula | C19H28O4S |
| Molecular Weight | 352.50 g/mol |
| Exact Mass | 352.17 |
| IUPAC Name | 2-(3-methylcyclohex-2-en-1-yl)-4-methylsulfonyl-5-pentylbenzene-1,3-diol |
| SMILES | CCCCCc1cc(O)c(C2C=C(C)CCC2)c(O)c1S(C)(=O)=O |
| InChI | InChI=1S/C19H28O4S/c1-4-5-6-9-15-12-16(20)17(14-10-7-8-13(2)11-14)18(21)19(15)24(3,22)23/h11-12,14,20-21H,4-10H2,1-3H3 |
| InChIKey | JHQXNAVAOUHLQP-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.50 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|