C21H32N2O5S — CID 155576141
2-amino-N-[2,4-dihydroxy-3-(3-methylcyclohex-2-en-1-yl)-6-pentylphenyl]sulfonylpropanamide (PubChem CID 155576141) has the molecular formula C21H32N2O5S and a molecular weight of 424.56 g/mol. Its IUPAC name is 2-amino-N-[2,4-dihydroxy-3-(3-methylcyclohex-2-en-1-yl)-6-pentylphenyl]sulfonylpropanamide.
| Compound Name | 2-amino-N-[2,4-dihydroxy-3-(3-methylcyclohex-2-en-1-yl)-6-pentylphenyl]sulfonylpropanamide |
|---|---|
| PubChem CID | 155576141 |
| Molecular Formula | C21H32N2O5S |
| Molecular Weight | 424.56 g/mol |
| Exact Mass | 424.20 |
| IUPAC Name | 2-amino-N-[2,4-dihydroxy-3-(3-methylcyclohex-2-en-1-yl)-6-pentylphenyl]sulfonylpropanamide |
| SMILES | CCCCCc1cc(O)c(C2C=C(C)CCC2)c(O)c1S(=O)(=O)NC(=O)C(C)N |
| InChI | InChI=1S/C21H32N2O5S/c1-4-5-6-9-16-12-17(24)18(15-10-7-8-13(2)11-15)19(25)20(16)29(27,28)23-21(26)14(3)22/h11-12,14-15,24-25H,4-10,22H2,1-3H3,(H,23,26) |
| InChIKey | UKMBKLFVZMDVTJ-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 129.72 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.56 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|