C28H35NO5S — CID 155576218
N-[2,4-dihydroxy-3-(3-methyl-6-prop-1-en-2-ylcyclohex-2-en-1-yl)-6-pentylphenyl]sulfonylbenzamide (PubChem CID 155576218) has the molecular formula C28H35NO5S and a molecular weight of 497.66 g/mol. Its IUPAC name is N-[2,4-dihydroxy-3-(3-methyl-6-prop-1-en-2-ylcyclohex-2-en-1-yl)-6-pentylphenyl]sulfonylbenzamide.
| Compound Name | N-[2,4-dihydroxy-3-(3-methyl-6-prop-1-en-2-ylcyclohex-2-en-1-yl)-6-pentylphenyl]sulfonylbenzamide |
|---|---|
| PubChem CID | 155576218 |
| Molecular Formula | C28H35NO5S |
| Molecular Weight | 497.66 g/mol |
| Exact Mass | 497.22 |
| IUPAC Name | N-[2,4-dihydroxy-3-(3-methyl-6-prop-1-en-2-ylcyclohex-2-en-1-yl)-6-pentylphenyl]sulfonylbenzamide |
| SMILES | C=C(C)C1CCC(C)=CC1c1c(O)cc(CCCCC)c(S(=O)(=O)NC(=O)c2ccccc2)c1O |
| InChI | InChI=1S/C28H35NO5S/c1-5-6-8-13-21-17-24(30)25(23-16-19(4)14-15-22(23)18(2)3)26(31)27(21)35(33,34)29-28(32)20-11-9-7-10-12-20/h7,9-12,16-17,22-23,30-31H,2,5-6,8,13-15H2,1,3-4H3,(H,29,32) |
| InChIKey | BRUOXOFWWWNTBR-UHFFFAOYSA-N |
| XLogP | 5.97 |
| TPSA | 103.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.66 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|