C22H32O — CID 158228926
5-methyl-2-[(6R)-3-methyl-6-prop-1-en-2-ylcyclohex-2-en-1-yl]-3-pentylphenol (PubChem CID 158228926) has the molecular formula C22H32O and a molecular weight of 312.50 g/mol. Its IUPAC name is 5-methyl-2-[(6R)-3-methyl-6-prop-1-en-2-ylcyclohex-2-en-1-yl]-3-pentylphenol.
| Compound Name | 5-methyl-2-[(6R)-3-methyl-6-prop-1-en-2-ylcyclohex-2-en-1-yl]-3-pentylphenol |
|---|---|
| PubChem CID | 158228926 |
| Molecular Formula | C22H32O |
| Molecular Weight | 312.50 g/mol |
| Exact Mass | 312.25 |
| IUPAC Name | 5-methyl-2-[(6R)-3-methyl-6-prop-1-en-2-ylcyclohex-2-en-1-yl]-3-pentylphenol |
| SMILES | C=C(C)[C@@H]1CCC(C)=CC1c1c(O)cc(C)cc1CCCCC |
| InChI | InChI=1S/C22H32O/c1-6-7-8-9-18-12-17(5)14-21(23)22(18)20-13-16(4)10-11-19(20)15(2)3/h12-14,19-20,23H,2,6-11H2,1,3-5H3/t19-,20?/m0/s1 |
| InChIKey | GEDIQMPFNNJVFH-XJDOXCRVSA-N |
| XLogP | 6.45 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.50 |
| LogP ≤ 5 | 6.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|