C28H45N2O2+ — CID 164973515
4-aza-1-azoniabicyclo[2.2.2]octane;4-methyl-2-[(1R,6R)-3-methyl-6-prop-1-en-2-ylcyclohex-2-en-1-yl]-5-pentylbenzene-1,3-diol (PubChem CID 164973515) has the molecular formula C28H45N2O2+ and a molecular weight of 441.68 g/mol. Its IUPAC name is 4-aza-1-azoniabicyclo[2.2.2]octane;4-methyl-2-[(1R,6R)-3-methyl-6-prop-1-en-2-ylcyclohex-2-en-1-yl]-5-pentylbenzene-1,3-diol.
| Compound Name | 4-aza-1-azoniabicyclo[2.2.2]octane;4-methyl-2-[(1R,6R)-3-methyl-6-prop-1-en-2-ylcyclohex-2-en-1-yl]-5-pentylbenzene-1,3-diol |
|---|---|
| PubChem CID | 164973515 |
| Molecular Formula | C28H45N2O2+ |
| Molecular Weight | 441.68 g/mol |
| Exact Mass | 441.35 |
| IUPAC Name | 4-aza-1-azoniabicyclo[2.2.2]octane;4-methyl-2-[(1R,6R)-3-methyl-6-prop-1-en-2-ylcyclohex-2-en-1-yl]-5-pentylbenzene-1,3-diol |
| SMILES | C1C[NH+]2CCN1CC2.C=C(C)[C@@H]1CCC(C)=C[C@H]1c1c(O)cc(CCCCC)c(C)c1O |
| InChI | InChI=1S/C22H32O2.C6H12N2/c1-6-7-8-9-17-13-20(23)21(22(24)16(17)5)19-12-15(4)10-11-18(19)14(2)3;1-2-8-5-3-7(1)4-6-8/h12-13,18-19,23-24H,2,6-11H2,1,3-5H3;1-6H2/p+1/t18-,19+;/m0./s1 |
| InChIKey | DLJQWLAIQXQTIZ-GRTNUQQKSA-O |
| XLogP | 4.36 |
| TPSA | 48.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.68 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|