C29H42O4 — CID 135244434
(1,5,5-trimethyl-2-bicyclo[2.2.1]heptanyl) 2,4-dihydroxy-3-(3-methylcyclohex-2-en-1-yl)-6-pentylbenzoate (PubChem CID 135244434) has the molecular formula C29H42O4 and a molecular weight of 454.65 g/mol. Its IUPAC name is (1,5,5-trimethyl-2-bicyclo[2.2.1]heptanyl) 2,4-dihydroxy-3-(3-methylcyclohex-2-en-1-yl)-6-pentylbenzoate.
| Compound Name | (1,5,5-trimethyl-2-bicyclo[2.2.1]heptanyl) 2,4-dihydroxy-3-(3-methylcyclohex-2-en-1-yl)-6-pentylbenzoate |
|---|---|
| PubChem CID | 135244434 |
| Molecular Formula | C29H42O4 |
| Molecular Weight | 454.65 g/mol |
| Exact Mass | 454.31 |
| IUPAC Name | (1,5,5-trimethyl-2-bicyclo[2.2.1]heptanyl) 2,4-dihydroxy-3-(3-methylcyclohex-2-en-1-yl)-6-pentylbenzoate |
| SMILES | CCCCCc1cc(O)c(C2C=C(C)CCC2)c(O)c1C(=O)OC1CC2CC1(C)CC2(C)C |
| InChI | InChI=1S/C29H42O4/c1-6-7-8-11-20-14-22(30)24(19-12-9-10-18(2)13-19)26(31)25(20)27(32)33-23-15-21-16-29(23,5)17-28(21,3)4/h13-14,19,21,23,30-31H,6-12,15-17H2,1-5H3 |
| InChIKey | IBYLKKLSZHUSSK-UHFFFAOYSA-N |
| XLogP | 7.42 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.65 |
| LogP ≤ 5 | 7.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|