C32H44O5 — CID 126581868
(1,5,5-trimethyl-2-bicyclo[2.2.1]heptanyl) 6-hydroxy-5-[(1R)-3-methyl-6-prop-1-en-2-ylcyclohex-2-en-1-yl]-3,4-dioxo-2-pentylcyclohexa-1,5-diene-1-carboxylate (PubChem CID 126581868) has the molecular formula C32H44O5 and a molecular weight of 508.70 g/mol. Its IUPAC name is (1,5,5-trimethyl-2-bicyclo[2.2.1]heptanyl) 6-hydroxy-5-[(1R)-3-methyl-6-prop-1-en-2-ylcyclohex-2-en-1-yl]-3,4-dioxo-2-pentylcyclohexa-1,5-diene-1-carboxylate.
| Compound Name | (1,5,5-trimethyl-2-bicyclo[2.2.1]heptanyl) 6-hydroxy-5-[(1R)-3-methyl-6-prop-1-en-2-ylcyclohex-2-en-1-yl]-3,4-dioxo-2-pentylcyclohexa-1,5-diene-1-carboxylate |
|---|---|
| PubChem CID | 126581868 |
| Molecular Formula | C32H44O5 |
| Molecular Weight | 508.70 g/mol |
| Exact Mass | 508.32 |
| IUPAC Name | (1,5,5-trimethyl-2-bicyclo[2.2.1]heptanyl) 6-hydroxy-5-[(1R)-3-methyl-6-prop-1-en-2-ylcyclohex-2-en-1-yl]-3,4-dioxo-2-pentylcyclohexa-1,5-diene-1-carboxylate |
| SMILES | C=C(C)C1CCC(C)=C[C@H]1C1=C(O)C(C(=O)OC2CC3CC2(C)CC3(C)C)=C(CCCCC)C(=O)C1=O |
| InChI | InChI=1S/C32H44O5/c1-8-9-10-11-22-26(30(36)37-24-15-20-16-32(24,7)17-31(20,5)6)28(34)25(29(35)27(22)33)23-14-19(4)12-13-21(23)18(2)3/h14,20-21,23-24,34H,2,8-13,15-17H2,1,3-7H3/t20?,21?,23-,24?,32?/m1/s1 |
| InChIKey | BDGHHIVBBVGFAW-MFOPGTDISA-N |
| XLogP | 7.13 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.70 |
| LogP ≤ 5 | 7.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'quinone_D(2)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'chinone_2', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|